Diethylene glycol butylether acetate ( dgba ) CAS 124-17-4 for silkscreen printing ink
| Names and Identifies | |
| Product Name | Ethanol, 2-(2-butoxyethoxy)-, acetate |
| Synonyms | Butoxyethoxyethyl acetate; Butyl carbitol acetate; Butyl diethylene glycol acetate; Diethylene glycol butyl ether acetate; Diethylene glycol monobutyl ether acetate; Diglycol monobutyl ether acetate; 2-(2-Butoxyethoxy)ethyl acetate; Diethylene glycol mono-n-butyl ether acetate; 2-(2-Butoxyethoxy)ethanol acetate; Acetic acid 2-(2-butoxyethoxy)ethyl ester; 2-(2-Butoxyethoxy)ethylester kyseliny octove; Butylkarbitolacetat; Ektasolve DB acetate; Glycol ether DB aceatate; 1-Butoxy-2-(2-acetoxyethoxy)-ethane; Butyl diglycol acetate; DE acetate; Ethanol, 2-(2-butoxyethoxy)-, 1-acetate; NSC 5175; Butoxyethanol acetate; Db acetate; Dba; Eastman db acetate |
| CAS No. | 124-17-4 |
| EINECS | 204-685-9 |
| Inchi | InChI=1S/C10H20O4/c1-3-4-5-12-6-7-13-8-9-14-10(2)11/h3-9H2,1-2H3 |
| Short for Name | DBAC |
| Appearance | Clear transparent liquid |
| Purity : |
≥99% |
| Physico-chemical Properties | |
| Molecular Formula: | C10H20O4 |
| Molecular | 204.2634 |
| Viscosity | ---- |
| Density | 0.974g/cm³ |
| Flash point: | 106.95ºC |
| Boiling point | 244.999ºC |
| Melting point | 32ºC |
| Vapour pressure | <0.01hPa(20°C) |
| Solubility | miscible |
| Refractive index | -- |
| Type | Dyestuff Intermediates, Syntheses Material Intermediates |
| Packages and Capacity | |
| Nornal pacakge | 200kgs/drum |
| MOQ | 1kg |
| Capactiy | 250MT/year |
| Application | |
|
DBAC is u
sed for printing ink oiling agent and roasting glaze oil, especially for silkscreen printing ink, car paint, TV paint, refrigerator paint and plane paint, etc high grade paint. Used for photosensitive chemicals.
|
|
| More Information | |
|
Stored in the dry and ventilated inside storeroom, prevent direct sunlight, slightly pile and put down
Customs HS Code:29153990 |
|
1.Q: How can you guarantee your quality?