Shanghai LongTome was established in 2023,it's a young and vigorous company specialize in chemical import and export.LongTome has a range of production line covering :General reagents, high purity reagents, pharmaceutical raw materials, food additives and chemical raw materials, etc.These products can widely be used in daily chemical,textile,leather,ink,coating,resin,electroplating,electronics,food,medicine and other industries.
| Names and Identifies | |
| Product Name | 2-Ethoxyethyl acetate |
| Synonyms |
2EEA
2-Ethoxyethanol acetate 2-ethoxyethanol, ester with acetic acid beta-ethoxyethyl acetate Cellosolve acetate CSAC ektasolve ee acetate solvent Ethoxyethanol acetate Ethoxyethyl acetate Ethyl acetyl glycolate Ethyl Cellosolve Acetate ethylene glycol ethyl ether acetate Ethylene glycol monethyl ether acetate Ethylene glycol monoethylether acetate Ethylglycol acetate glycol ether ee acetate Glycol, monoethyl ether acetate oxytol acetate poly-solv ee acetate Ethylene Glycol Monoethyl Ether Acetate CAC 1-ethoxyethyl acetate ethyl ethaneperoxoate |
| CAS No. | 111-15-9 |
| EINECS | 203-839-2 |
| Inchi | InChI=1/C6H12O3/c1-3-8-4-5-9-6(2)7/h3-5H2,1-2H3 |
| Short for Name | CAC |
| Appearance | Clear transparent liquid |
| Purity : |
≥98.5% |
| Physico-chemical Properties | |
| Molecular Formula: | C6H12O3 |
| Molecular | 132.16 |
| Viscosity | ---- |
| Density | 0.965~0.975 |
| Flash point: | 47ºC |
| Boiling point | 156.4ºC |
| Melting point | -61°C |
| Vapour pressure | 0.16kPa/20ºC |
| Solubility | 230 g/L (20 ºC) |
| Refractive index | -- |
| Surface tension | -- |
| Type |
Syntheses Material Intermediates |
| Packages and Capacity | |
| Nornal pacakge | 200kgs/drum |
| MOQ | 1kg |
| Capactiy | 250MT/year |
| Application | |
|
1.
It is mainly used as s
olvent for metal and furniture painting, solvent for painting.
2.It is used as solvent for protective coatings, dyes, resins, leather and inks. 3.It is used in the formulation of hard surface cleaning agents such as metal and glass. 4.It is used as chemical reagent. |
|
| More Information | |
| Stored in the dry and ventilated inside storeroom, prevent direct sunlight, slightly pile and put down | |
1.Q: How can you guarantee your quality?